CAS 929972-27-0 appears in our catalog under these names: (6-Nitroimidazo[1,2-a]pyridin-8-yl)(phenyl)methanone, 95%, 8-Benzoyl-6-nitroimidazo(1,2-a)pyridine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(6-nitroimidazo[1,2-a]pyridin-8-yl)-phenylmethanone (CAS 929972-27-0) is a chemical compound with the molecular formula C14H9N3O3 and a molecular weight of 267.24 g/mol. IUPAC name: (6-nitroimidazo[1,2-a]pyridin-8-yl)-phenylmethanone. InChIKey: CWUDSDLHFXWVAQ-UHFFFAOYSA-N.
| Molecular formula | C14H9N3O3 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | (6-nitroimidazo[1,2-a]pyridin-8-yl)-phenylmethanone |
| InChIKey | CWUDSDLHFXWVAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=CN3C2=NC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)