CAS 69139-53-3 appears in our catalog under these names: 2–(4–Nitrophenyl)phthalazin–1(2H)–one, 2-(4-Nitrophenyl)phthalazin-1(2H)-one, 98%. Offered by: GLPBio, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
2-(4-nitrophenyl)phthalazin-1-one (CAS 69139-53-3) is a chemical compound with the molecular formula C14H9N3O3 and a molecular weight of 267.24 g/mol. IUPAC name: 2-(4-nitrophenyl)phthalazin-1-one. InChIKey: FCVWQIJQXGNAEL-UHFFFAOYSA-N.
| Molecular formula | C14H9N3O3 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 2-(4-nitrophenyl)phthalazin-1-one |
| InChIKey | FCVWQIJQXGNAEL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NN(C2=O)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)