CAS 20844-74-0 appears in our catalog under these names: 2(3H)-Benzoxazolone, 3-(3-hydroxypropyl)-, 97%, 3-(3-Hydroxypropyl)-2,3-dihydro-1,3-benzoxazol-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(3-hydroxypropyl)-1,3-benzoxazol-2-one (CAS 20844-74-0) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 3-(3-hydroxypropyl)-1,3-benzoxazol-2-one. InChIKey: PNPDJORVEQMXOW-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 3-(3-hydroxypropyl)-1,3-benzoxazol-2-one |
| InChIKey | PNPDJORVEQMXOW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C(=O)O2)CCCO |
Computed by PubChem (NCBI)