CAS 208772-21-8 is the registry number for 3-Amino-2-(methylamino)benzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-amino-2-(methylamino)benzoic acid;hydrochloride (CAS 208772-21-8) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: 3-amino-2-(methylamino)benzoic acid;hydrochloride. InChIKey: MXLWIKGLKYBOMI-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 3-amino-2-(methylamino)benzoic acid;hydrochloride |
| InChIKey | MXLWIKGLKYBOMI-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=CC=C1N)C(=O)O.Cl |
Computed by PubChem (NCBI)