Products 208772-23-0
CAS 208772-23-0 appears in our catalog under these names: Benzo(d)oxazole–4–carboxylic acid, 1,3-Benzoxazole-4-carboxylic acid, Benzo[d]oxazole-4-carboxylic acid 97%, Benzo[d]oxazole-4-carboxylic acid, 97%, 97%, Benzo[d]oxazole-4-carboxylic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 10g, 50mg, 5g.
1,3-benzoxazole-4-carboxylic acid (CAS 208772-23-0) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 1,3-benzoxazole-4-carboxylic acid. InChIKey: KRCCCWVXRVDONW-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 1,3-benzoxazole-4-carboxylic acid |
| InChIKey | KRCCCWVXRVDONW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC=N2)C(=O)O |
Computed by PubChem (NCBI)