CAS 208772-24-1 appears in our catalog under these names: Benzo[d]oxazole-7-carboxylic acid, 95%, Benzo(d)oxazole-7-carboxylic acid, Benzo[d]oxazole-7-carboxylic acid 97%, 7-Benzoxazolecarboxylic acid, 97%, 97%, Benzooxazole-7-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 100mg, 5g.
1,3-benzoxazole-7-carboxylic acid (CAS 208772-24-1) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 1,3-benzoxazole-7-carboxylic acid. InChIKey: JHTQTAYWCUAENJ-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 1,3-benzoxazole-7-carboxylic acid |
| InChIKey | JHTQTAYWCUAENJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)N=CO2)C(=O)O |
Computed by PubChem (NCBI)