CAS 20884-61-1 is the registry number for 4-(Isopropylsulfonyl)benzoic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 250mg.
4-propan-2-ylsulfonylbenzoic acid (CAS 20884-61-1) is a chemical compound with the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. IUPAC name: 4-propan-2-ylsulfonylbenzoic acid. InChIKey: BOJGIPHAFYLYRH-UHFFFAOYSA-N.
| Molecular formula | C10H12O4S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 4-propan-2-ylsulfonylbenzoic acid |
| InChIKey | BOJGIPHAFYLYRH-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)