Products 6178-52-5
CAS 6178-52-5 appears in our catalog under these names: 4-Benzenesulfonyl-butyric acid, 95%, 4-(Phenylsulfonyl)butanoic acid 95%, 4-(Phenylsulfonyl)butanoic acid, 98%, 98%, 4-Benzenesulfonyl-butyric acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
4-(benzenesulfonyl)butanoic acid (CAS 6178-52-5) is a chemical compound with the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. IUPAC name: 4-(benzenesulfonyl)butanoic acid. InChIKey: DBHMOMYHWIMTRS-UHFFFAOYSA-N.
| Molecular formula | C10H12O4S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 4-(benzenesulfonyl)butanoic acid |
| InChIKey | DBHMOMYHWIMTRS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CCCC(=O)O |
Computed by PubChem (NCBI)