Products 95735-63-0

CAS 95735-63-0 is the registry number for 2-(3,4-Dimethoxyphenylthio)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(3,4-dimethoxyphenyl)sulfanylacetic acid (CAS 95735-63-0) is a chemical compound with the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)sulfanylacetic acid. InChIKey: ANVXBTSSFGHHBD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O4S
Molecular weight228.27 g/mol
IUPAC name2-(3,4-dimethoxyphenyl)sulfanylacetic acid
InChIKeyANVXBTSSFGHHBD-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)SCC(=O)O)OC

Computed by PubChem (NCBI)