Products 2089649-40-9
CAS 2089649-40-9 is the registry number for Methyl 5-carbamoyl-2-chlorobenzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Methyl 5-carbamoyl-2-chlorobenzoate (CAS 2089649-40-9) is a chemical compound with the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. IUPAC name: methyl 5-carbamoyl-2-chlorobenzoate. InChIKey: PJGQJJCMJBNONV-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | methyl 5-carbamoyl-2-chlorobenzoate |
| InChIKey | PJGQJJCMJBNONV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C(=O)N)Cl |
Computed by PubChem (NCBI)
Synonyms:
methyl 5-carbamoyl-2-chloro-benzoate