CAS 208993-97-9 is the registry number for Methyl 7–amino–2–phenylthieno(2,3–b)pyrazine–6–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Methyl 7-amino-2-phenylthieno[2,3-b]pyrazine-6-carboxylate (CAS 208993-97-9) is a chemical compound with the molecular formula C14H11N3O2S and a molecular weight of 285.32 g/mol. IUPAC name: methyl 7-amino-2-phenylthieno[2,3-b]pyrazine-6-carboxylate. InChIKey: PZACMQHJOUOYGV-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2S |
|---|---|
| Molecular weight | 285.32 g/mol |
| IUPAC name | methyl 7-amino-2-phenylthieno[2,3-b]pyrazine-6-carboxylate |
| InChIKey | PZACMQHJOUOYGV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=NC(=CN=C2S1)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)