Products 208993-97-9

CAS 208993-97-9 is the registry number for Methyl 7–amino–2–phenylthieno(2,3–b)pyrazine–6–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 7-amino-2-phenylthieno[2,3-b]pyrazine-6-carboxylate (CAS 208993-97-9) is a chemical compound with the molecular formula C14H11N3O2S and a molecular weight of 285.32 g/mol. IUPAC name: methyl 7-amino-2-phenylthieno[2,3-b]pyrazine-6-carboxylate. InChIKey: PZACMQHJOUOYGV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11N3O2S
Molecular weight285.32 g/mol
IUPAC namemethyl 7-amino-2-phenylthieno[2,3-b]pyrazine-6-carboxylate
InChIKeyPZACMQHJOUOYGV-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C2=NC(=CN=C2S1)C3=CC=CC=C3)N

Computed by PubChem (NCBI)