Products 750640-55-2

CAS 750640-55-2 is the registry number for GP130 modulator-2, 99.15%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 25 mg, 5 mg, 10 mg, 50 mg.

Structural formula: {0} (CAS {1})

N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-1,2-oxazole-5-carboxamide (CAS 750640-55-2) is a chemical compound with the molecular formula C14H11N3O2S and a molecular weight of 285.32 g/mol. IUPAC name: N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-1,2-oxazole-5-carboxamide. InChIKey: WDTUFJHIGJTNSD-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11N3O2S
Molecular weight285.32 g/mol
IUPAC nameN-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-1,2-oxazole-5-carboxamide
InChIKeyWDTUFJHIGJTNSD-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=CSC(=N2)NC(=O)C3=CC=NO3

Computed by PubChem (NCBI)