CAS 89374-59-4 is the registry number for 1-(4-Methoxyphenyl)-2-thioxo-2,3-dihydropyrido[2,3-d]pyrimidin-4(1H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-methoxyphenyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one (CAS 89374-59-4) is a chemical compound with the molecular formula C14H11N3O2S and a molecular weight of 285.32 g/mol. IUPAC name: 1-(4-methoxyphenyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one. InChIKey: HCAFQEQAMMNBLP-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2S |
|---|---|
| Molecular weight | 285.32 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one |
| InChIKey | HCAFQEQAMMNBLP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C3=C(C=CC=N3)C(=O)NC2=S |
Computed by PubChem (NCBI)