CAS 2383046-49-7 is the registry number for (E)-N'-(4-Carbonitrilbenzylidene)Benzenesulfonohydrazide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
N-[(E)-(4-cyanophenyl)methylideneamino]benzenesulfonamide (CAS 2383046-49-7) is a chemical compound with the molecular formula C14H11N3O2S and a molecular weight of 285.32 g/mol. IUPAC name: N-[(E)-(4-cyanophenyl)methylideneamino]benzenesulfonamide. InChIKey: FWANZNVPCBFZLT-LFIBNONCSA-N.
| Molecular formula | C14H11N3O2S |
|---|---|
| Molecular weight | 285.32 g/mol |
| IUPAC name | N-[(E)-(4-cyanophenyl)methylideneamino]benzenesulfonamide |
| InChIKey | FWANZNVPCBFZLT-LFIBNONCSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)