Products 851943-50-5
CAS 851943-50-5 is the registry number for N-Benzyl-5-oxo-5H-thiazolo[3,2-a]pyrimidine-6-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-benzyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (CAS 851943-50-5) is a chemical compound with the molecular formula C14H11N3O2S and a molecular weight of 285.32 g/mol. IUPAC name: N-benzyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide. InChIKey: WSMICNGEIUVPHR-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2S |
|---|---|
| Molecular weight | 285.32 g/mol |
| IUPAC name | N-benzyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| InChIKey | WSMICNGEIUVPHR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=CN=C3N(C2=O)C=CS3 |
Computed by PubChem (NCBI)