CAS 875160-56-8 is the registry number for N-(4-(2-Amino-1,3-thiazol-4-yl)phenyl)furan-2-carboxamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]furan-2-carboxamide (CAS 875160-56-8) is a chemical compound with the molecular formula C14H11N3O2S and a molecular weight of 285.32 g/mol. IUPAC name: N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]furan-2-carboxamide. InChIKey: WOSOYKKMIMIFIV-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2S |
|---|---|
| Molecular weight | 285.32 g/mol |
| IUPAC name | N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]furan-2-carboxamide |
| InChIKey | WOSOYKKMIMIFIV-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)NC2=CC=C(C=C2)C3=CSC(=N3)N |
Computed by PubChem (NCBI)