Products 20902-48-1

CAS 20902-48-1 is the registry number for N-(2-Ethoxy-2-oxoacetyl)-L-alanine ethyl ester, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl (2S)-2-[(2-ethoxy-2-oxoacetyl)amino]propanoate (CAS 20902-48-1) is a chemical compound with the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. IUPAC name: ethyl (2S)-2-[(2-ethoxy-2-oxoacetyl)amino]propanoate. InChIKey: WBQQDEUSGHGJMH-LURJTMIESA-N.

Identity
Molecular formulaC9H15NO5
Molecular weight217.22 g/mol
IUPAC nameethyl (2S)-2-[(2-ethoxy-2-oxoacetyl)amino]propanoate
InChIKeyWBQQDEUSGHGJMH-LURJTMIESA-N
SMILESCCOC(=O)[C@H](C)NC(=O)C(=O)OCC

Computed by PubChem (NCBI)