Products 2090465-60-2
CAS 2090465-60-2 is the registry number for 2-Bromo-5-fluoro-3-(trifluoromethyl)benzoic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-5-fluoro-3-(trifluoromethyl)benzoic acid (CAS 2090465-60-2) is a chemical compound with the molecular formula C8H3BrF4O2 and a molecular weight of 287.01 g/mol. IUPAC name: 2-bromo-5-fluoro-3-(trifluoromethyl)benzoic acid. InChIKey: QLYHCNJYLABCTH-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF4O2 |
|---|---|
| Molecular weight | 287.01 g/mol |
| IUPAC name | 2-bromo-5-fluoro-3-(trifluoromethyl)benzoic acid |
| InChIKey | QLYHCNJYLABCTH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Br)C(F)(F)F)F |
Computed by PubChem (NCBI)