Products 2091487-65-7
CAS 2091487-65-7 is the registry number for Methyl 2,6-dichloro-4,5-dimethylnicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,6-dichloro-4,5-dimethylpyridine-3-carboxylate (CAS 2091487-65-7) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: methyl 2,6-dichloro-4,5-dimethylpyridine-3-carboxylate. InChIKey: ZVOXQRXUBCFHHV-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | methyl 2,6-dichloro-4,5-dimethylpyridine-3-carboxylate |
| InChIKey | ZVOXQRXUBCFHHV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=C1C(=O)OC)Cl)Cl)C |
Computed by PubChem (NCBI)