CAS 2091494-76-5 appears in our catalog under these names: 3–Methyl–5–phenyl–1H–pyrrole–2–carboxylic acid, 3-Methyl-5-phenyl-1H-pyrrole-2-carboxylic acid, 97%, 97%, 3-Methyl-5-phenyl-1H-pyrrole-2-carboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-methyl-5-phenyl-1H-pyrrole-2-carboxylic acid (CAS 2091494-76-5) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 3-methyl-5-phenyl-1H-pyrrole-2-carboxylic acid. InChIKey: QXORJYQIJUIMIT-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 3-methyl-5-phenyl-1H-pyrrole-2-carboxylic acid |
| InChIKey | QXORJYQIJUIMIT-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=C1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)