CAS 2091511-83-8 is the registry number for 1-(1-Bromoethyl)-3-(trifluoromethoxy)benzene. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg, 5000mg.
1-(1-bromoethyl)-3-(trifluoromethoxy)benzene (CAS 2091511-83-8) is a chemical compound with the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. IUPAC name: 1-(1-bromoethyl)-3-(trifluoromethoxy)benzene. InChIKey: HMPAHCNDFSKKBN-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O |
|---|---|
| Molecular weight | 269.06 g/mol |
| IUPAC name | 1-(1-bromoethyl)-3-(trifluoromethoxy)benzene |
| InChIKey | HMPAHCNDFSKKBN-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)OC(F)(F)F)Br |
Computed by PubChem (NCBI)