CAS 20916-14-7 is the registry number for N-Methyl-2-(4-nitrophenoxy)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g.
N-methyl-2-(4-nitrophenoxy)acetamide (CAS 20916-14-7) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: N-methyl-2-(4-nitrophenoxy)acetamide. InChIKey: JPBSEPMSDPWLKY-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | N-methyl-2-(4-nitrophenoxy)acetamide |
| InChIKey | JPBSEPMSDPWLKY-UHFFFAOYSA-N |
| SMILES | CNC(=O)COC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)