Products 2092153-65-4

CAS 2092153-65-4 is the registry number for 5-Methyl-2-(6-methylpyridin-3-yl)-1H-imidazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-methyl-2-(6-methyl-3-pyridinyl)-1H-imidazole-4-carboxylic acid (CAS 2092153-65-4) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: 5-methyl-2-(6-methyl-3-pyridinyl)-1H-imidazole-4-carboxylic acid. InChIKey: QPOXTWRELVEBKC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11N3O2
Molecular weight217.22 g/mol
IUPAC name5-methyl-2-(6-methyl-3-pyridinyl)-1H-imidazole-4-carboxylic acid
InChIKeyQPOXTWRELVEBKC-UHFFFAOYSA-N
SMILESCC1=NC=C(C=C1)C2=NC(=C(N2)C)C(=O)O

Computed by PubChem (NCBI)