CAS 2092594-03-9 is the registry number for 2-Chloro-5,8-dimethylquinolin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-5,8-dimethylquinolin-4-amine (CAS 2092594-03-9) is a chemical compound with the molecular formula C11H11ClN2 and a molecular weight of 206.67 g/mol. IUPAC name: 2-chloro-5,8-dimethylquinolin-4-amine. InChIKey: NWFCOZQWXHYAGZ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2 |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | 2-chloro-5,8-dimethylquinolin-4-amine |
| InChIKey | NWFCOZQWXHYAGZ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC(=NC2=C(C=C1)C)Cl)N |
Computed by PubChem (NCBI)