CAS 2092668-02-3 is the registry number for 4-Chloro-5-methoxy-1-methyl-1H-indole-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-5-methoxy-1-methylindole-2-carboxylic acid (CAS 2092668-02-3) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: 4-chloro-5-methoxy-1-methylindole-2-carboxylic acid. InChIKey: QXKPIUXWTRDBJU-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3 |
|---|---|
| Molecular weight | 239.65 g/mol |
| IUPAC name | 4-chloro-5-methoxy-1-methylindole-2-carboxylic acid |
| InChIKey | QXKPIUXWTRDBJU-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C1C(=O)O)C(=C(C=C2)OC)Cl |
Computed by PubChem (NCBI)