Products 2095409-86-0
CAS 2095409-86-0 is the registry number for 7-((Dimethylamino)methyl)-2,2-difluoro-1,3-dioxaindane-4-carbaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-[(dimethylamino)methyl]-2,2-difluoro-1,3-benzodioxole-4-carbaldehyde (CAS 2095409-86-0) is a chemical compound with the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. IUPAC name: 7-[(dimethylamino)methyl]-2,2-difluoro-1,3-benzodioxole-4-carbaldehyde. InChIKey: OPSYXYGFVCPDNR-UHFFFAOYSA-N.
| Molecular formula | C11H11F2NO3 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 7-[(dimethylamino)methyl]-2,2-difluoro-1,3-benzodioxole-4-carbaldehyde |
| InChIKey | OPSYXYGFVCPDNR-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=C2C(=C(C=C1)C=O)OC(O2)(F)F |
Computed by PubChem (NCBI)