Products 2095410-58-3

CAS 2095410-58-3 is the registry number for Methyl 4-amino-3-ethoxybenzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 4-amino-3-ethoxybenzoate;hydrochloride (CAS 2095410-58-3) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 4-amino-3-ethoxybenzoate;hydrochloride. InChIKey: DRCIOHKUCIIIOW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClNO3
Molecular weight231.67 g/mol
IUPAC namemethyl 4-amino-3-ethoxybenzoate;hydrochloride
InChIKeyDRCIOHKUCIIIOW-UHFFFAOYSA-N
SMILESCCOC1=C(C=CC(=C1)C(=O)OC)N.Cl

Computed by PubChem (NCBI)