CAS 2095410-58-3 is the registry number for Methyl 4-amino-3-ethoxybenzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl 4-amino-3-ethoxybenzoate;hydrochloride (CAS 2095410-58-3) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 4-amino-3-ethoxybenzoate;hydrochloride. InChIKey: DRCIOHKUCIIIOW-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl 4-amino-3-ethoxybenzoate;hydrochloride |
| InChIKey | DRCIOHKUCIIIOW-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C(=O)OC)N.Cl |
Computed by PubChem (NCBI)