CAS 2096985-31-6 is the registry number for 5-[2-(Anilinocarbonyl)phenyl]-1,3-oxazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
5-[2-(phenylcarbamoyl)phenyl]-1,3-oxazole-4-carboxylic acid (CAS 2096985-31-6) is a chemical compound with the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. IUPAC name: 5-[2-(phenylcarbamoyl)phenyl]-1,3-oxazole-4-carboxylic acid. InChIKey: YMSPGNUGGGCWFT-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O4 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | 5-[2-(phenylcarbamoyl)phenyl]-1,3-oxazole-4-carboxylic acid |
| InChIKey | YMSPGNUGGGCWFT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2C3=C(N=CO3)C(=O)O |
Computed by PubChem (NCBI)