CAS 929519-89-1 appears in our catalog under these names: 4-(5-Cyano-1,3-dioxo-1h-benzo[de]isoquinolin-2(3h)-yl)butanoic acid, 95%, 4-(5-Cyano-1,3-dioxo-1H-benzo(de)isoquinolin-2(3H)-yl)butanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
4-(5-cyano-1,3-dioxobenzo[de]isoquinolin-2-yl)butanoic acid (CAS 929519-89-1) is a chemical compound with the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. IUPAC name: 4-(5-cyano-1,3-dioxobenzo[de]isoquinolin-2-yl)butanoic acid. InChIKey: SLTOYMBCVBSJGQ-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O4 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | 4-(5-cyano-1,3-dioxobenzo[de]isoquinolin-2-yl)butanoic acid |
| InChIKey | SLTOYMBCVBSJGQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC3=C2C(=C1)C(=O)N(C3=O)CCCC(=O)O)C#N |
Computed by PubChem (NCBI)