CAS 458151-34-3 appears in our catalog under these names: Thalidomide-benzo, 98%, Thalidomide–benzo, Thalidomide-benzo. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, Get quote.
2-(2,6-dioxopiperidin-3-yl)benzo[f]isoindole-1,3-dione (CAS 458151-34-3) is a chemical compound with the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)benzo[f]isoindole-1,3-dione. InChIKey: WEZVWZZGZAYKRL-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O4 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)benzo[f]isoindole-1,3-dione |
| InChIKey | WEZVWZZGZAYKRL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=CC4=CC=CC=C4C=C3C2=O |
Computed by PubChem (NCBI)