CAS 95498-20-7 is the registry number for 4-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)phenyl N-phenylcarbamate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
[4-(2,5-dioxopyrrol-1-yl)phenyl] N-phenylcarbamate (CAS 95498-20-7) is a chemical compound with the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. IUPAC name: [4-(2,5-dioxopyrrol-1-yl)phenyl] N-phenylcarbamate. InChIKey: FLMJKAYWSNAGDG-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O4 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | [4-(2,5-dioxopyrrol-1-yl)phenyl] N-phenylcarbamate |
| InChIKey | FLMJKAYWSNAGDG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)OC2=CC=C(C=C2)N3C(=O)C=CC3=O |
Computed by PubChem (NCBI)