CAS 6596-48-1 is the registry number for 7-Chloro-4-methyl-2H-chromen-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2-methylphenyl)-2-(3-nitrophenyl)-1,3-oxazin-6-one (CAS 6596-48-1) is a chemical compound with the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. IUPAC name: 4-(2-methylphenyl)-2-(3-nitrophenyl)-1,3-oxazin-6-one. InChIKey: XAWRZMYBQFHEMH-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O4 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | 4-(2-methylphenyl)-2-(3-nitrophenyl)-1,3-oxazin-6-one |
| InChIKey | XAWRZMYBQFHEMH-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC(=O)OC(=N2)C3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)