Products 2270877-19-3

CAS 2270877-19-3 is the registry number for 4'-(1H-Imidazol-1-yl)-[1,1'-biphenyl]-3,5-dicarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(4-imidazol-1-ylphenyl)benzene-1,3-dicarboxylic acid (CAS 2270877-19-3) is a chemical compound with the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. IUPAC name: 5-(4-imidazol-1-ylphenyl)benzene-1,3-dicarboxylic acid. InChIKey: RWNPELJXZJVZLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H12N2O4
Molecular weight308.29 g/mol
IUPAC name5-(4-imidazol-1-ylphenyl)benzene-1,3-dicarboxylic acid
InChIKeyRWNPELJXZJVZLJ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)N3C=CN=C3

Computed by PubChem (NCBI)