CAS 2270877-19-3 is the registry number for 4'-(1H-Imidazol-1-yl)-[1,1'-biphenyl]-3,5-dicarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-imidazol-1-ylphenyl)benzene-1,3-dicarboxylic acid (CAS 2270877-19-3) is a chemical compound with the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. IUPAC name: 5-(4-imidazol-1-ylphenyl)benzene-1,3-dicarboxylic acid. InChIKey: RWNPELJXZJVZLJ-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O4 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | 5-(4-imidazol-1-ylphenyl)benzene-1,3-dicarboxylic acid |
| InChIKey | RWNPELJXZJVZLJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)N3C=CN=C3 |
Computed by PubChem (NCBI)