CAS 2101811-41-8 appears in our catalog under these names: Diroximel Fumarate Impurity 2, (E)-4-(2-(2,5-Dioxopyrrolidin-1-yl)ethoxy)-4-oxobut-2-enoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(E)-4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxy]-4-oxobut-2-enoic acid (CAS 2101811-41-8) is a chemical compound with the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. IUPAC name: (E)-4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxy]-4-oxobut-2-enoic acid. InChIKey: MOWUWAPJWBBZTN-ONEGZZNKSA-N.
| Molecular formula | C10H11NO6 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | (E)-4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxy]-4-oxobut-2-enoic acid |
| InChIKey | MOWUWAPJWBBZTN-ONEGZZNKSA-N |
| SMILES | C1CC(=O)N(C1=O)CCOC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)