Products 2101811-42-9
CAS 2101811-42-9 appears in our catalog under these names: Diroximel Fumarate Impurity 6, 1-(2-(2,5-Dioxo-1-pyrrolidinyl)ethyl) (2Z)-2-butenedioate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
(Z)-4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxy]-4-oxobut-2-enoic acid (CAS 2101811-42-9) is a chemical compound with the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. IUPAC name: (Z)-4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxy]-4-oxobut-2-enoic acid. InChIKey: MOWUWAPJWBBZTN-ARJAWSKDSA-N.
| Molecular formula | C10H11NO6 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | (Z)-4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxy]-4-oxobut-2-enoic acid |
| InChIKey | MOWUWAPJWBBZTN-ARJAWSKDSA-N |
| SMILES | C1CC(=O)N(C1=O)CCOC(=O)/C=C\C(=O)O |
Computed by PubChem (NCBI)