Products 2102919-66-2
CAS 2102919-66-2 appears in our catalog under these names: 9-([1,1'-Biphenyl]-3-yl)-9H-3,9'-bicarbazole, 95%, 95%, 9-([1,1'-Biphenyl]-3-yl)-9H-3,9'-bicarbazole, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
3-carbazol-9-yl-9-(3-phenylphenyl)carbazole (CAS 2102919-66-2) is a chemical compound with the molecular formula C36H24N2 and a molecular weight of 484.6 g/mol. IUPAC name: 3-carbazol-9-yl-9-(3-phenylphenyl)carbazole. InChIKey: PPQRPUFUVGSKPQ-UHFFFAOYSA-N.
| Molecular formula | C36H24N2 |
|---|---|
| Molecular weight | 484.6 g/mol |
| IUPAC name | 3-carbazol-9-yl-9-(3-phenylphenyl)carbazole |
| InChIKey | PPQRPUFUVGSKPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)N3C4=C(C=C(C=C4)N5C6=CC=CC=C6C7=CC=CC=C75)C8=CC=CC=C83 |
Computed by PubChem (NCBI)