Products 2107210-05-7
CAS 2107210-05-7 is the registry number for 5-(tert-Butyl) 2-methyl 6,7-dihydrofuro[3,2-c]pyridine-2,5(4H)-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-O-tert-butyl 2-O-methyl 6,7-dihydro-4H-furo[3,2-c]pyridine-2,5-dicarboxylate (CAS 2107210-05-7) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: 5-O-tert-butyl 2-O-methyl 6,7-dihydro-4H-furo[3,2-c]pyridine-2,5-dicarboxylate. InChIKey: YGLOGZIPJXCXAX-UHFFFAOYSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 5-O-tert-butyl 2-O-methyl 6,7-dihydro-4H-furo[3,2-c]pyridine-2,5-dicarboxylate |
| InChIKey | YGLOGZIPJXCXAX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=C(O2)C(=O)OC |
Computed by PubChem (NCBI)