CAS 210816-49-2 appears in our catalog under these names: 1-(2,4-Bis(difluoromethoxy)phenyl)ethan-1-one, 95%, 1-(2,4-Bis(difluoromethoxy)phenyl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
1-[2,4-bis(difluoromethoxy)phenyl]ethanone (CAS 210816-49-2) is a chemical compound with the molecular formula C10H8F4O3 and a molecular weight of 252.16 g/mol. IUPAC name: 1-[2,4-bis(difluoromethoxy)phenyl]ethanone. InChIKey: PGPIQACNLBOEMR-UHFFFAOYSA-N.
| Molecular formula | C10H8F4O3 |
|---|---|
| Molecular weight | 252.16 g/mol |
| IUPAC name | 1-[2,4-bis(difluoromethoxy)phenyl]ethanone |
| InChIKey | PGPIQACNLBOEMR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)OC(F)F)OC(F)F |
Computed by PubChem (NCBI)