CAS 21094-70-2 is the registry number for 2-((Benzenesulfonyl)methyl)-1H-1,3-benzodiazole. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(benzenesulfonylmethyl)-1H-benzimidazole (CAS 21094-70-2) is a chemical compound with the molecular formula C14H12N2O2S and a molecular weight of 272.32 g/mol. IUPAC name: 2-(benzenesulfonylmethyl)-1H-benzimidazole. InChIKey: KVUPWJMSALRLRJ-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | 2-(benzenesulfonylmethyl)-1H-benzimidazole |
| InChIKey | KVUPWJMSALRLRJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CC2=NC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)