CAS 2110053-04-6 is the registry number for 6-Oxo-3,4-dihydro-2H,6H-pyrimido[2,1-b][1,3]thiazine-7-carbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carbonitrile (CAS 2110053-04-6) is a chemical compound with the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. IUPAC name: 6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carbonitrile. InChIKey: QBEOHKNQHHCSTI-UHFFFAOYSA-N.
| Molecular formula | C8H7N3OS |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | 6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carbonitrile |
| InChIKey | QBEOHKNQHHCSTI-UHFFFAOYSA-N |
| SMILES | C1CN2C(=O)C(=CN=C2SC1)C#N |
Computed by PubChem (NCBI)