CAS 2112007-02-8 is the registry number for Ethyl 2-amino-2-(2-methyl-1-oxo-1,2-dihydroisoquinolin-7-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-amino-2-(2-methyl-1-oxoisoquinolin-7-yl)acetate (CAS 2112007-02-8) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: ethyl 2-amino-2-(2-methyl-1-oxoisoquinolin-7-yl)acetate. InChIKey: ZIJJQCDJIYWLFJ-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | ethyl 2-amino-2-(2-methyl-1-oxoisoquinolin-7-yl)acetate |
| InChIKey | ZIJJQCDJIYWLFJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC2=C(C=C1)C=CN(C2=O)C)N |
Computed by PubChem (NCBI)