CAS 2112842-07-4 is the registry number for 1,3-Dibromo-5-(2,2,2-trifluoroethoxy)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-dibromo-5-(2,2,2-trifluoroethoxy)benzene (CAS 2112842-07-4) is a chemical compound with the molecular formula C8H5Br2F3O and a molecular weight of 333.93 g/mol. IUPAC name: 1,3-dibromo-5-(2,2,2-trifluoroethoxy)benzene. InChIKey: PFCJBJDUGXTELH-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2F3O |
|---|---|
| Molecular weight | 333.93 g/mol |
| IUPAC name | 1,3-dibromo-5-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | PFCJBJDUGXTELH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)OCC(F)(F)F |
Computed by PubChem (NCBI)