Products 2112894-04-7
CAS 2112894-04-7 is the registry number for Methyl 2-ethyl-7-fluoro-1H-indole-3-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 2-ethyl-7-fluoro-1H-indole-3-carboxylate (CAS 2112894-04-7) is a chemical compound with the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. IUPAC name: methyl 2-ethyl-7-fluoro-1H-indole-3-carboxylate. InChIKey: GAKOZWKYXXASDO-UHFFFAOYSA-N.
| Molecular formula | C12H12FNO2 |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | methyl 2-ethyl-7-fluoro-1H-indole-3-carboxylate |
| InChIKey | GAKOZWKYXXASDO-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=C(N1)C(=CC=C2)F)C(=O)OC |
Computed by PubChem (NCBI)