CAS 2113-55-5 appears in our catalog under these names: 3-Aminobiphenyl Hydrochloride, >95% (HPLC), 3–Aminobiphenyl hydrochloride, [1,1'-Biphenyl]-3-amine hydrochloride 96%, 3-Aminobiphenyl hydrochloride, 95%. Offered by: TRC, GLPBio, Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 2g, 25g, 5g, 10g.
3-phenylaniline;hydrochloride (CAS 2113-55-5) is a chemical compound with the molecular formula C12H12ClN and a molecular weight of 205.68 g/mol. IUPAC name: 3-phenylaniline;hydrochloride. InChIKey: FFNBBUJVAUTTPK-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 3-phenylaniline;hydrochloride |
| InChIKey | FFNBBUJVAUTTPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)