CAS 21149-17-7 appears in our catalog under these names: Z–dehydro–Ala–OMe, Z-Dehydroalanine methyl ester 98%, Z-DEHYDRO-ALA-OME, >=98.0%, Methyl 2-(((benzyloxy)carbonyl)amino)acrylate, 96%, 96%, N-CBZ-DEHYDROALANINE METHYL ESTER, 96%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
Methyl 2-(phenylmethoxycarbonylamino)prop-2-enoate (CAS 21149-17-7) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: methyl 2-(phenylmethoxycarbonylamino)prop-2-enoate. InChIKey: STFUIEDYPRMRNN-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | methyl 2-(phenylmethoxycarbonylamino)prop-2-enoate |
| InChIKey | STFUIEDYPRMRNN-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=C)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)