Products 21160-02-1

CAS 21160-02-1 is the registry number for Benzophenone O-acetyl oxime, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

(benzhydrylideneamino) acetate (CAS 21160-02-1) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: (benzhydrylideneamino) acetate. InChIKey: WLQZJFNXRBLFAB-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13NO2
Molecular weight239.27 g/mol
IUPAC name(benzhydrylideneamino) acetate
InChIKeyWLQZJFNXRBLFAB-UHFFFAOYSA-N
SMILESCC(=O)ON=C(C1=CC=CC=C1)C2=CC=CC=C2

Computed by PubChem (NCBI)