Products 2121511-47-3

CAS 2121511-47-3 appears in our catalog under these names: 2,3-Difluoro-6-isopropoxyphenylboronic acid, 95%, 2,3-Difluoro-6-isopropoxyphenylboronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(2,3-difluoro-6-propan-2-yloxyphenyl)boronic acid (CAS 2121511-47-3) is a chemical compound with the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. IUPAC name: (2,3-difluoro-6-propan-2-yloxyphenyl)boronic acid. InChIKey: RBMPKVJAQZVPLN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BF2O3
Molecular weight215.99 g/mol
IUPAC name(2,3-difluoro-6-propan-2-yloxyphenyl)boronic acid
InChIKeyRBMPKVJAQZVPLN-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1F)F)OC(C)C)(O)O

Computed by PubChem (NCBI)