Products 2121512-68-1
CAS 2121512-68-1 is the registry number for 3-Formyl-4-methoxy-5-methylphenyl boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
(3-formyl-4-methoxy-5-methylphenyl)boronic acid (CAS 2121512-68-1) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: (3-formyl-4-methoxy-5-methylphenyl)boronic acid. InChIKey: JNGRWCFPRBLQFM-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | (3-formyl-4-methoxy-5-methylphenyl)boronic acid |
| InChIKey | JNGRWCFPRBLQFM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C=O)OC)C)(O)O |
Computed by PubChem (NCBI)