CAS 2121514-40-5 appears in our catalog under these names: 4,5-Dimethyl-2-isopropoxyphenylboronic acid, 95%, 4,5-Dimethyl-2-isopropoxyphenylboronic acid, ≥95%, ≥95%, 4,5-Dimethyl-2-isopropoxyphenylboronic acid, >=95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
(4,5-dimethyl-2-propan-2-yloxyphenyl)boronic acid (CAS 2121514-40-5) is a chemical compound with the molecular formula C11H17BO3 and a molecular weight of 208.06 g/mol. IUPAC name: (4,5-dimethyl-2-propan-2-yloxyphenyl)boronic acid. InChIKey: RMQBMQUHPUPYCV-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3 |
|---|---|
| Molecular weight | 208.06 g/mol |
| IUPAC name | (4,5-dimethyl-2-propan-2-yloxyphenyl)boronic acid |
| InChIKey | RMQBMQUHPUPYCV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OC(C)C)C)C)(O)O |
Computed by PubChem (NCBI)