Products 2121515-24-8

Name: 2,5-Difluoro-4-isopropoxyphenylboronic acid, 95%
Availability: InStock

CAS 2121515-24-8 is the registry number for 2,5-Difluoro-4-isopropoxyphenylboronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

2,5-Difluoro-4-isopropoxyphenylboronic acid, 95%

Combi-blocks, AmBeed

size: 5g, 10g, 25g, 1g
Variants: 8

from 7602.07

View product

(2,5-difluoro-4-propan-2-yloxyphenyl)boronic acid (CAS 2121515-24-8) is a chemical compound with the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. IUPAC name: (2,5-difluoro-4-propan-2-yloxyphenyl)boronic acid. InChIKey: YTHPCUDGIPWCFU-UHFFFAOYSA-N.

Identity
Molecular formula	C₉H₁₁BF₂O₃
Molecular weight	215.99 g/mol
IUPAC name	(2,5-difluoro-4-propan-2-yloxyphenyl)boronic acid
InChIKey	YTHPCUDGIPWCFU-UHFFFAOYSA-N
SMILES	B(C1=CC(=C(C=C1F)OC(C)C)F)(O)O

Computed by PubChem (NCBI)

Synonyms: 2,5-Difluoro-4-isopropoxyphenylboronic acid, 2,,5-Difluoro-4-isopropoxyphenylboronic acid, (2,5-difluoro-4-isopropoxy-phenyl)boronic acid, (2,5-difluoro-4-propan-2-yloxyphenyl)boronic acid

Products 2121515-24-8

2,5-Difluoro-4-isopropoxyphenylboronic acid, 95%

Isomers (same molecular formula)